C17H22N3O3S+ — CID 7270325
N-(3-morpholin-4-ium-4-ylpropylcarbamothioyl)-1-benzofuran-2-carboxamide (PubChem CID 7270325) has the molecular formula C17H22N3O3S+ and a molecular weight of 348.45 g/mol. Its IUPAC name is N-(3-morpholin-4-ium-4-ylpropylcarbamothioyl)-1-benzofuran-2-carboxamide.
| Compound Name | N-(3-morpholin-4-ium-4-ylpropylcarbamothioyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 7270325 |
| Molecular Formula | C17H22N3O3S+ |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | N-(3-morpholin-4-ium-4-ylpropylcarbamothioyl)-1-benzofuran-2-carboxamide |
| SMILES | O=C(NC(=S)NCCC[NH+]1CCOCC1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C17H21N3O3S/c21-16(15-12-13-4-1-2-5-14(13)23-15)19-17(24)18-6-3-7-20-8-10-22-11-9-20/h1-2,4-5,12H,3,6-11H2,(H2,18,19,21,24)/p+1 |
| InChIKey | RVUCYRJXKGZBSQ-UHFFFAOYSA-O |
| XLogP | 0.34 |
| TPSA | 67.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|