C16H12N2O3S — CID 822277
N-[(2-hydroxyphenyl)carbamothioyl]-1-benzofuran-2-carboxamide (PubChem CID 822277) has the molecular formula C16H12N2O3S and a molecular weight of 312.35 g/mol. Its IUPAC name is N-[(2-hydroxyphenyl)carbamothioyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[(2-hydroxyphenyl)carbamothioyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 822277 |
| Molecular Formula | C16H12N2O3S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | N-[(2-hydroxyphenyl)carbamothioyl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccccc1O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C16H12N2O3S/c19-12-7-3-2-6-11(12)17-16(22)18-15(20)14-9-10-5-1-4-8-13(10)21-14/h1-9,19H,(H2,17,18,20,22) |
| InChIKey | KMUWPDXMKMTYTQ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|