C17H10Cl2N2O4S — CID 50849978
4-(1-benzofuran-2-carbonylcarbamothioylamino)-3,5-dichlorobenzoic acid (PubChem CID 50849978) has the molecular formula C17H10Cl2N2O4S and a molecular weight of 409.25 g/mol. Its IUPAC name is 4-(1-benzofuran-2-carbonylcarbamothioylamino)-3,5-dichlorobenzoic acid.
| Compound Name | 4-(1-benzofuran-2-carbonylcarbamothioylamino)-3,5-dichlorobenzoic acid |
|---|---|
| PubChem CID | 50849978 |
| Molecular Formula | C17H10Cl2N2O4S |
| Molecular Weight | 409.25 g/mol |
| Exact Mass | 407.97 |
| IUPAC Name | 4-(1-benzofuran-2-carbonylcarbamothioylamino)-3,5-dichlorobenzoic acid |
| SMILES | O=C(O)c1cc(Cl)c(NC(=S)NC(=O)c2cc3ccccc3o2)c(Cl)c1 |
| InChI | InChI=1S/C17H10Cl2N2O4S/c18-10-5-9(16(23)24)6-11(19)14(10)20-17(26)21-15(22)13-7-8-3-1-2-4-12(8)25-13/h1-7H,(H,23,24)(H2,20,21,22,26) |
| InChIKey | VHAFEJYHDVMZCQ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.25 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|