C23H15ClN4O2S — CID 17104325
N-[[5-(1H-benzimidazol-2-yl)-2-chlorophenyl]carbamothioyl]-1-benzofuran-2-carboxamide (PubChem CID 17104325) has the molecular formula C23H15ClN4O2S and a molecular weight of 446.92 g/mol. Its IUPAC name is N-[[5-(1H-benzimidazol-2-yl)-2-chlorophenyl]carbamothioyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[[5-(1H-benzimidazol-2-yl)-2-chlorophenyl]carbamothioyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 17104325 |
| Molecular Formula | C23H15ClN4O2S |
| Molecular Weight | 446.92 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | N-[[5-(1H-benzimidazol-2-yl)-2-chlorophenyl]carbamothioyl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1cc(-c2nc3ccccc3[nH]2)ccc1Cl)c1cc2ccccc2o1 |
| InChI | InChI=1S/C23H15ClN4O2S/c24-15-10-9-14(21-25-16-6-2-3-7-17(16)26-21)11-18(15)27-23(31)28-22(29)20-12-13-5-1-4-8-19(13)30-20/h1-12H,(H,25,26)(H2,27,28,29,31) |
| InChIKey | FBFQLPMEQCNMDW-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.92 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|