C19H26N5O+ — CID 9194600
4,6-dimethyl-N-[(Z)-[(1S)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-ylidene]amino]pyrimidin-2-amine (PubChem CID 9194600) has the molecular formula C19H26N5O+ and a molecular weight of 340.45 g/mol. Its IUPAC name is 4,6-dimethyl-N-[(Z)-[(1S)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-ylidene]amino]pyrimidin-2-amine.
| Compound Name | 4,6-dimethyl-N-[(Z)-[(1S)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-ylidene]amino]pyrimidin-2-amine |
|---|---|
| PubChem CID | 9194600 |
| Molecular Formula | C19H26N5O+ |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | 4,6-dimethyl-N-[(Z)-[(1S)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-ylidene]amino]pyrimidin-2-amine |
| SMILES | C/C(=N/Nc1nc(C)cc(C)n1)[C@H](c1ccccc1)[NH+]1CCOCC1 |
| InChI | InChI=1S/C19H25N5O/c1-14-13-15(2)21-19(20-14)23-22-16(3)18(17-7-5-4-6-8-17)24-9-11-25-12-10-24/h4-8,13,18H,9-12H2,1-3H3,(H,20,21,23)/p+1/b22-16-/t18-/m1/s1 |
| InChIKey | RTOFJUGHVFTCLI-ZSYKKXJESA-O |
| XLogP | 1.54 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|