C19H24N3O2S+ — CID 9295932
N-[(Z)-[(1S)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-ylidene]amino]-2-thiophen-2-ylacetamide (PubChem CID 9295932) has the molecular formula C19H24N3O2S+ and a molecular weight of 358.49 g/mol. Its IUPAC name is N-[(Z)-[(1S)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-ylidene]amino]-2-thiophen-2-ylacetamide.
| Compound Name | N-[(Z)-[(1S)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-ylidene]amino]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 9295932 |
| Molecular Formula | C19H24N3O2S+ |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | N-[(Z)-[(1S)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-ylidene]amino]-2-thiophen-2-ylacetamide |
| SMILES | C/C(=N/NC(=O)Cc1cccs1)[C@H](c1ccccc1)[NH+]1CCOCC1 |
| InChI | InChI=1S/C19H23N3O2S/c1-15(20-21-18(23)14-17-8-5-13-25-17)19(16-6-3-2-4-7-16)22-9-11-24-12-10-22/h2-8,13,19H,9-12,14H2,1H3,(H,21,23)/p+1/b20-15-/t19-/m1/s1 |
| InChIKey | YSLTXTFWMOMIHI-GCFJHJGGSA-O |
| XLogP | 1.44 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|