C24H30N6S — CID 163213863
N-[(E)-6,7-dihydro-5H-quinolin-8-ylideneamino]-9-pyridin-2-yl-3,9-diazaspiro[5.5]undecane-3-carbothioamide (PubChem CID 163213863) has the molecular formula C24H30N6S and a molecular weight of 434.61 g/mol. Its IUPAC name is N-[(E)-6,7-dihydro-5H-quinolin-8-ylideneamino]-9-pyridin-2-yl-3,9-diazaspiro[5.5]undecane-3-carbothioamide.
| Compound Name | N-[(E)-6,7-dihydro-5H-quinolin-8-ylideneamino]-9-pyridin-2-yl-3,9-diazaspiro[5.5]undecane-3-carbothioamide |
|---|---|
| PubChem CID | 163213863 |
| Molecular Formula | C24H30N6S |
| Molecular Weight | 434.61 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | N-[(E)-6,7-dihydro-5H-quinolin-8-ylideneamino]-9-pyridin-2-yl-3,9-diazaspiro[5.5]undecane-3-carbothioamide |
| SMILES | S=C(N/N=C1\CCCc2cccnc21)N1CCC2(CC1)CCN(c1ccccn1)CC2 |
| InChI | InChI=1S/C24H30N6S/c31-23(28-27-20-7-3-5-19-6-4-14-26-22(19)20)30-17-11-24(12-18-30)9-15-29(16-10-24)21-8-1-2-13-25-21/h1-2,4,6,8,13-14H,3,5,7,9-12,15-18H2,(H,28,31)/b27-20+ |
| InChIKey | FVBWDISUXSYNHO-NHFJDJAPSA-N |
| XLogP | 3.77 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.61 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|