C12H18CuN4S+2 — CID 50911193
copper 1-butyl-3-[(6-methyl-2-pyridinyl)methylideneamino]thiourea (PubChem CID 50911193) has the molecular formula C12H18CuN4S+2 and a molecular weight of 313.92 g/mol. Its IUPAC name is copper 1-butyl-3-[(6-methyl-2-pyridinyl)methylideneamino]thiourea.
| Compound Name | copper 1-butyl-3-[(6-methyl-2-pyridinyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 50911193 |
| Molecular Formula | C12H18CuN4S+2 |
| Molecular Weight | 313.92 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | copper 1-butyl-3-[(6-methyl-2-pyridinyl)methylideneamino]thiourea |
| SMILES | CCCCNC(=S)NN=Cc1cccc(C)n1.[Cu+2] |
| InChI | InChI=1S/C12H18N4S.Cu/c1-3-4-8-13-12(17)16-14-9-11-7-5-6-10(2)15-11;/h5-7,9H,3-4,8H2,1-2H3,(H2,13,16,17);/q;+2 |
| InChIKey | AMOYXCCYCKQZBH-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.92 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|