About copper;bis(methyl N-[(6-methyl-2-pyridinyl)methylideneamino]carbamodithioate)
copper;bis(methyl N-[(6-methyl-2-pyridinyl)methylideneamino]carbamodithioate) (PubChem CID 50919597) has the molecular formula C18H22CuN6S4
and a molecular weight of 514.23 g/mol. Its IUPAC name is copper;bis(methyl N-[(6-methyl-2-pyridinyl)methylideneamino]carbamodithioate).
Molecular Properties
| Compound Name | copper;bis(methyl N-[(6-methyl-2-pyridinyl)methylideneamino]carbamodithioate) |
| PubChem CID | 50919597 |
| Molecular Formula | C18H22CuN6S4 |
| Molecular Weight | 514.23 g/mol |
| Exact Mass | 513.01 |
| IUPAC Name | copper;bis(methyl N-[(6-methyl-2-pyridinyl)methylideneamino]carbamodithioate) |
| SMILES | CSC(=S)NN=Cc1cccc(C)n1.CSC(=S)NN=Cc1cccc(C)n1.[Cu] |
| InChI | InChI=1S/2C9H11N3S2.Cu/c2*1-7-4-3-5-8(11-7)6-10-12-9(13)14-2;/h2*3-6H,1-2H3,(H,12,13); |
| InChIKey | KAXDLZAADUWTNF-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 74.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 514.23 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze copper;bis(methyl N-[(6-methyl-2-pyridinyl)methylideneamino]carbamodithioate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;bis(methyl N-[(6-methyl-2-pyridinyl)methylideneamino]carbamodithioate)?
The IUPAC name of copper;bis(methyl N-[(6-methyl-2-pyridinyl)methylideneamino]carbamodithioate) (CID 50919597) is copper;bis(methyl N-[(6-methyl-2-pyridinyl)methylideneamino]carbamodithioate).
What is the SMILES notation for copper;bis(methyl N-[(6-methyl-2-pyridinyl)methylideneamino]carbamodithioate)?
The canonical SMILES for copper;bis(methyl N-[(6-methyl-2-pyridinyl)methylideneamino]carbamodithioate) is CSC(=S)NN=Cc1cccc(C)n1.CSC(=S)NN=Cc1cccc(C)n1.[Cu].
What is the InChIKey of copper;bis(methyl N-[(6-methyl-2-pyridinyl)methylideneamino]carbamodithioate)?
The InChIKey is KAXDLZAADUWTNF-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H11N3S2.Cu/c2*1-7-4-3-5-8(11-7)6-10-12-9(13)14-2;/h2*3-6H,1-2H3,(H,12,13);.
What are the key properties of copper;bis(methyl N-[(6-methyl-2-pyridinyl)methylideneamino]carbamodithioate)?
copper;bis(methyl N-[(6-methyl-2-pyridinyl)methylideneamino]carbamodithioate) has a molecular weight of 514.23 g/mol, XLogP of 3.92, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for copper;bis(methyl N-[(6-methyl-2-pyridinyl)methylideneamino]carbamodithioate) is sourced from PubChem (CID 50919597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).