C13H13N7 — CID 53440400
1,2-bis(pyridin-2-ylmethylideneamino)guanidine (PubChem CID 53440400) has the molecular formula C13H13N7 and a molecular weight of 267.30 g/mol. Its IUPAC name is 1,2-bis(pyridin-2-ylmethylideneamino)guanidine.
| Compound Name | 1,2-bis(pyridin-2-ylmethylideneamino)guanidine |
|---|---|
| PubChem CID | 53440400 |
| Molecular Formula | C13H13N7 |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 1,2-bis(pyridin-2-ylmethylideneamino)guanidine |
| SMILES | NC(=NN=Cc1ccccn1)NN=Cc1ccccn1 |
| InChI | InChI=1S/C13H13N7/c14-13(19-17-9-11-5-1-3-7-15-11)20-18-10-12-6-2-4-8-16-12/h1-10H,(H3,14,19,20) |
| InChIKey | XEIKZJBHMXHDRL-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 100.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|