C10H9N5S — CID 75146831
(1,8-naphthyridin-2-ylmethylideneamino)thiourea (PubChem CID 75146831) has the molecular formula C10H9N5S and a molecular weight of 231.28 g/mol. Its IUPAC name is (1,8-naphthyridin-2-ylmethylideneamino)thiourea.
| Compound Name | (1,8-naphthyridin-2-ylmethylideneamino)thiourea |
|---|---|
| PubChem CID | 75146831 |
| Molecular Formula | C10H9N5S |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | (1,8-naphthyridin-2-ylmethylideneamino)thiourea |
| SMILES | NC(=S)NN=Cc1ccc2cccnc2n1 |
| InChI | InChI=1S/C10H9N5S/c11-10(16)15-13-6-8-4-3-7-2-1-5-12-9(7)14-8/h1-6H,(H3,11,15,16) |
| InChIKey | WIVGRUDOWSBQSR-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|