C15H12N4OS2 — CID 3119183
[(5-quinolin-8-ylsulfanylfuran-2-yl)methylideneamino]thiourea (PubChem CID 3119183) has the molecular formula C15H12N4OS2 and a molecular weight of 328.42 g/mol. Its IUPAC name is [(5-quinolin-8-ylsulfanylfuran-2-yl)methylideneamino]thiourea.
| Compound Name | [(5-quinolin-8-ylsulfanylfuran-2-yl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 3119183 |
| Molecular Formula | C15H12N4OS2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | [(5-quinolin-8-ylsulfanylfuran-2-yl)methylideneamino]thiourea |
| SMILES | NC(=S)NN=Cc1ccc(Sc2cccc3cccnc23)o1 |
| InChI | InChI=1S/C15H12N4OS2/c16-15(21)19-18-9-11-6-7-13(20-11)22-12-5-1-3-10-4-2-8-17-14(10)12/h1-9H,(H3,16,19,21) |
| InChIKey | HYBMPBLDCBZMKL-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|