About methyl N-(isoquinolin-1-ylmethylideneamino)carbamodithioate;trichloroiron
methyl N-(isoquinolin-1-ylmethylideneamino)carbamodithioate;trichloroiron (PubChem CID 50912503) has the molecular formula C12H11Cl3FeN3S2
and a molecular weight of 423.58 g/mol. Its IUPAC name is methyl N-(isoquinolin-1-ylmethylideneamino)carbamodithioate;trichloroiron.
Molecular Properties
| Compound Name | methyl N-(isoquinolin-1-ylmethylideneamino)carbamodithioate;trichloroiron |
| PubChem CID | 50912503 |
| Molecular Formula | C12H11Cl3FeN3S2 |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 421.88 |
| IUPAC Name | methyl N-(isoquinolin-1-ylmethylideneamino)carbamodithioate;trichloroiron |
| SMILES | CSC(=S)NN=Cc1nccc2ccccc12.Cl[Fe](Cl)Cl |
| InChI | InChI=1S/C12H11N3S2.3ClH.Fe/c1-17-12(16)15-14-8-11-10-5-3-2-4-9(10)6-7-13-11;;;;/h2-8H,1H3,(H,15,16);3*1H;/q;;;;+3/p-3 |
| InChIKey | GATSXKYQSAZUFE-UHFFFAOYSA-K |
| XLogP | 4.87 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze methyl N-(isoquinolin-1-ylmethylideneamino)carbamodithioate;trichloroiron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-(isoquinolin-1-ylmethylideneamino)carbamodithioate;trichloroiron?
The IUPAC name of methyl N-(isoquinolin-1-ylmethylideneamino)carbamodithioate;trichloroiron (CID 50912503) is methyl N-(isoquinolin-1-ylmethylideneamino)carbamodithioate;trichloroiron.
What is the SMILES notation for methyl N-(isoquinolin-1-ylmethylideneamino)carbamodithioate;trichloroiron?
The canonical SMILES for methyl N-(isoquinolin-1-ylmethylideneamino)carbamodithioate;trichloroiron is CSC(=S)NN=Cc1nccc2ccccc12.Cl[Fe](Cl)Cl.
What is the InChIKey of methyl N-(isoquinolin-1-ylmethylideneamino)carbamodithioate;trichloroiron?
The InChIKey is GATSXKYQSAZUFE-UHFFFAOYSA-K. The full InChI is InChI=1S/C12H11N3S2.3ClH.Fe/c1-17-12(16)15-14-8-11-10-5-3-2-4-9(10)6-7-13-11;;;;/h2-8H,1H3,(H,15,16);3*1H;/q;;;;+3/p-3.
What are the key properties of methyl N-(isoquinolin-1-ylmethylideneamino)carbamodithioate;trichloroiron?
methyl N-(isoquinolin-1-ylmethylideneamino)carbamodithioate;trichloroiron has a molecular weight of 423.58 g/mol, XLogP of 4.87, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-(isoquinolin-1-ylmethylideneamino)carbamodithioate;trichloroiron is sourced from PubChem (CID 50912503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).