C9H14N4S2 — CID 135697225
methyl N-[(E)-(2-propyl-1H-imidazol-5-yl)methylideneamino]carbamodithioate (PubChem CID 135697225) has the molecular formula C9H14N4S2 and a molecular weight of 242.37 g/mol. Its IUPAC name is methyl N-[(E)-(2-propyl-1H-imidazol-5-yl)methylideneamino]carbamodithioate.
| Compound Name | methyl N-[(E)-(2-propyl-1H-imidazol-5-yl)methylideneamino]carbamodithioate |
|---|---|
| PubChem CID | 135697225 |
| Molecular Formula | C9H14N4S2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | methyl N-[(E)-(2-propyl-1H-imidazol-5-yl)methylideneamino]carbamodithioate |
| SMILES | CCCc1ncc(/C=N/NC(=S)SC)[nH]1 |
| InChI | InChI=1S/C9H14N4S2/c1-3-4-8-10-5-7(12-8)6-11-13-9(14)15-2/h5-6H,3-4H2,1-2H3,(H,10,12)(H,13,14)/b11-6+ |
| InChIKey | ZERHGAZTVAVLAD-IZZDOVSWSA-N |
| XLogP | 1.93 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|