About dichlorocopper;methyl N-(isoquinolin-1-ylmethylideneamino)carbamodithioate
dichlorocopper;methyl N-(isoquinolin-1-ylmethylideneamino)carbamodithioate (PubChem CID 50910008) has the molecular formula C12H11Cl2CuN3S2
and a molecular weight of 395.83 g/mol. Its IUPAC name is dichlorocopper;methyl N-(isoquinolin-1-ylmethylideneamino)carbamodithioate.
Molecular Properties
| Compound Name | dichlorocopper;methyl N-(isoquinolin-1-ylmethylideneamino)carbamodithioate |
| PubChem CID | 50910008 |
| Molecular Formula | C12H11Cl2CuN3S2 |
| Molecular Weight | 395.83 g/mol |
| Exact Mass | 393.91 |
| IUPAC Name | dichlorocopper;methyl N-(isoquinolin-1-ylmethylideneamino)carbamodithioate |
| SMILES | CSC(=S)NN=Cc1nccc2ccccc12.Cl[Cu]Cl |
| InChI | InChI=1S/C12H11N3S2.2ClH.Cu/c1-17-12(16)15-14-8-11-10-5-3-2-4-9(10)6-7-13-11;;;/h2-8H,1H3,(H,15,16);2*1H;/q;;;+2/p-2 |
| InChIKey | XFNPKLFOPOVYQU-UHFFFAOYSA-L |
| XLogP | 4.18 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.83 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze dichlorocopper;methyl N-(isoquinolin-1-ylmethylideneamino)carbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorocopper;methyl N-(isoquinolin-1-ylmethylideneamino)carbamodithioate?
The IUPAC name of dichlorocopper;methyl N-(isoquinolin-1-ylmethylideneamino)carbamodithioate (CID 50910008) is dichlorocopper;methyl N-(isoquinolin-1-ylmethylideneamino)carbamodithioate.
What is the SMILES notation for dichlorocopper;methyl N-(isoquinolin-1-ylmethylideneamino)carbamodithioate?
The canonical SMILES for dichlorocopper;methyl N-(isoquinolin-1-ylmethylideneamino)carbamodithioate is CSC(=S)NN=Cc1nccc2ccccc12.Cl[Cu]Cl.
What is the InChIKey of dichlorocopper;methyl N-(isoquinolin-1-ylmethylideneamino)carbamodithioate?
The InChIKey is XFNPKLFOPOVYQU-UHFFFAOYSA-L. The full InChI is InChI=1S/C12H11N3S2.2ClH.Cu/c1-17-12(16)15-14-8-11-10-5-3-2-4-9(10)6-7-13-11;;;/h2-8H,1H3,(H,15,16);2*1H;/q;;;+2/p-2.
What are the key properties of dichlorocopper;methyl N-(isoquinolin-1-ylmethylideneamino)carbamodithioate?
dichlorocopper;methyl N-(isoquinolin-1-ylmethylideneamino)carbamodithioate has a molecular weight of 395.83 g/mol, XLogP of 4.18, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorocopper;methyl N-(isoquinolin-1-ylmethylideneamino)carbamodithioate is sourced from PubChem (CID 50910008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).