About hydron;isoquinoline-1-carbaldehyde
hydron;isoquinoline-1-carbaldehyde (PubChem CID 174514236) has the molecular formula C10H8NO+
and a molecular weight of 158.18 g/mol. Its IUPAC name is hydron;isoquinoline-1-carbaldehyde.
Molecular Properties
| Compound Name | hydron;isoquinoline-1-carbaldehyde |
| PubChem CID | 174514236 |
| Molecular Formula | C10H8NO+ |
| Molecular Weight | 158.18 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | hydron;isoquinoline-1-carbaldehyde |
| SMILES | O=Cc1nccc2ccccc12.[H+] |
| InChI | InChI=1S/C10H7NO/c12-7-10-9-4-2-1-3-8(9)5-6-11-10/h1-7H/p+1 |
| InChIKey | HORFVOWTVOJVAN-UHFFFAOYSA-O |
| XLogP | 2.16 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.18 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze hydron;isoquinoline-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;isoquinoline-1-carbaldehyde?
The IUPAC name of hydron;isoquinoline-1-carbaldehyde (CID 174514236) is hydron;isoquinoline-1-carbaldehyde.
What is the SMILES notation for hydron;isoquinoline-1-carbaldehyde?
The canonical SMILES for hydron;isoquinoline-1-carbaldehyde is O=Cc1nccc2ccccc12.[H+].
What is the InChIKey of hydron;isoquinoline-1-carbaldehyde?
The InChIKey is HORFVOWTVOJVAN-UHFFFAOYSA-O. The full InChI is InChI=1S/C10H7NO/c12-7-10-9-4-2-1-3-8(9)5-6-11-10/h1-7H/p+1.
What are the key properties of hydron;isoquinoline-1-carbaldehyde?
hydron;isoquinoline-1-carbaldehyde has a molecular weight of 158.18 g/mol, XLogP of 2.16, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;isoquinoline-1-carbaldehyde is sourced from PubChem (CID 174514236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).