C12H7N3O2 — CID 63949892
3-isoquinolin-1-yl-1,2,4-oxadiazole-5-carbaldehyde (PubChem CID 63949892) has the molecular formula C12H7N3O2 and a molecular weight of 225.21 g/mol. Its IUPAC name is 3-isoquinolin-1-yl-1,2,4-oxadiazole-5-carbaldehyde.
| Compound Name | 3-isoquinolin-1-yl-1,2,4-oxadiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 63949892 |
| Molecular Formula | C12H7N3O2 |
| Molecular Weight | 225.21 g/mol |
| Exact Mass | 225.05 |
| IUPAC Name | 3-isoquinolin-1-yl-1,2,4-oxadiazole-5-carbaldehyde |
| SMILES | O=Cc1nc(-c2nccc3ccccc23)no1 |
| InChI | InChI=1S/C12H7N3O2/c16-7-10-14-12(15-17-10)11-9-4-2-1-3-8(9)5-6-13-11/h1-7H |
| InChIKey | BWMXWRCOMYOREC-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 68.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.21 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|