C13H12N4O2 — CID 63949235
2-amino-2-(3-isoquinolin-1-yl-1,2,4-oxadiazol-5-yl)ethanol (PubChem CID 63949235) has the molecular formula C13H12N4O2 and a molecular weight of 256.26 g/mol. Its IUPAC name is 2-amino-2-(3-isoquinolin-1-yl-1,2,4-oxadiazol-5-yl)ethanol.
| Compound Name | 2-amino-2-(3-isoquinolin-1-yl-1,2,4-oxadiazol-5-yl)ethanol |
|---|---|
| PubChem CID | 63949235 |
| Molecular Formula | C13H12N4O2 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 2-amino-2-(3-isoquinolin-1-yl-1,2,4-oxadiazol-5-yl)ethanol |
| SMILES | NC(CO)c1nc(-c2nccc3ccccc23)no1 |
| InChI | InChI=1S/C13H12N4O2/c14-10(7-18)13-16-12(17-19-13)11-9-4-2-1-3-8(9)5-6-15-11/h1-6,10,18H,7,14H2 |
| InChIKey | DLIOWHVKYMIOII-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |