C14H11N3O3 — CID 79475323
methyl 2-(3-isoquinolin-1-yl-1,2,4-oxadiazol-5-yl)acetate (PubChem CID 79475323) has the molecular formula C14H11N3O3 and a molecular weight of 269.26 g/mol. Its IUPAC name is methyl 2-(3-isoquinolin-1-yl-1,2,4-oxadiazol-5-yl)acetate.
| Compound Name | methyl 2-(3-isoquinolin-1-yl-1,2,4-oxadiazol-5-yl)acetate |
|---|---|
| PubChem CID | 79475323 |
| Molecular Formula | C14H11N3O3 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | methyl 2-(3-isoquinolin-1-yl-1,2,4-oxadiazol-5-yl)acetate |
| SMILES | COC(=O)Cc1nc(-c2nccc3ccccc23)no1 |
| InChI | InChI=1S/C14H11N3O3/c1-19-12(18)8-11-16-14(17-20-11)13-10-5-3-2-4-9(10)6-7-15-13/h2-7H,8H2,1H3 |
| InChIKey | MLYJKNCBOCYPRK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 78.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |