About formic acid;1-methylisoquinoline
formic acid;1-methylisoquinoline (PubChem CID 175196109) has the molecular formula C11H11NO2
and a molecular weight of 189.21 g/mol. Its IUPAC name is formic acid;1-methylisoquinoline.
Molecular Properties
| Compound Name | formic acid;1-methylisoquinoline |
| PubChem CID | 175196109 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | formic acid;1-methylisoquinoline |
| SMILES | Cc1nccc2ccccc12.O=CO |
| InChI | InChI=1S/C10H9N.CH2O2/c1-8-10-5-3-2-4-9(10)6-7-11-8;2-1-3/h2-7H,1H3;1H,(H,2,3) |
| InChIKey | BVHGUCGEHNGPPU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze formic acid;1-methylisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formic acid;1-methylisoquinoline?
The IUPAC name of formic acid;1-methylisoquinoline (CID 175196109) is formic acid;1-methylisoquinoline.
What is the SMILES notation for formic acid;1-methylisoquinoline?
The canonical SMILES for formic acid;1-methylisoquinoline is Cc1nccc2ccccc12.O=CO.
What is the InChIKey of formic acid;1-methylisoquinoline?
The InChIKey is BVHGUCGEHNGPPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N.CH2O2/c1-8-10-5-3-2-4-9(10)6-7-11-8;2-1-3/h2-7H,1H3;1H,(H,2,3).
What are the key properties of formic acid;1-methylisoquinoline?
formic acid;1-methylisoquinoline has a molecular weight of 189.21 g/mol, XLogP of 2.24, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for formic acid;1-methylisoquinoline is sourced from PubChem (CID 175196109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).