About formic acid;naphthalene;hydrochloride
formic acid;naphthalene;hydrochloride (PubChem CID 172855923) has the molecular formula C11H11ClO2
and a molecular weight of 210.66 g/mol. Its IUPAC name is formic acid;naphthalene;hydrochloride.
Molecular Properties
| Compound Name | formic acid;naphthalene;hydrochloride |
| PubChem CID | 172855923 |
| Molecular Formula | C11H11ClO2 |
| Molecular Weight | 210.66 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | formic acid;naphthalene;hydrochloride |
| SMILES | Cl.O=CO.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.CH2O2.ClH/c1-2-6-10-8-4-3-7-9(10)5-1;2-1-3;/h1-8H;1H,(H,2,3);1H |
| InChIKey | YRXLFWJJWWEGNS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.66 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze formic acid;naphthalene;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formic acid;naphthalene;hydrochloride?
The IUPAC name of formic acid;naphthalene;hydrochloride (CID 172855923) is formic acid;naphthalene;hydrochloride.
What is the SMILES notation for formic acid;naphthalene;hydrochloride?
The canonical SMILES for formic acid;naphthalene;hydrochloride is Cl.O=CO.c1ccc2ccccc2c1.
What is the InChIKey of formic acid;naphthalene;hydrochloride?
The InChIKey is YRXLFWJJWWEGNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.CH2O2.ClH/c1-2-6-10-8-4-3-7-9(10)5-1;2-1-3;/h1-8H;1H,(H,2,3);1H.
What are the key properties of formic acid;naphthalene;hydrochloride?
formic acid;naphthalene;hydrochloride has a molecular weight of 210.66 g/mol, XLogP of 2.96, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for formic acid;naphthalene;hydrochloride is sourced from PubChem (CID 172855923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).