About naphthalene;prop-2-enal
naphthalene;prop-2-enal (PubChem CID 174260828) has the molecular formula C13H12O
and a molecular weight of 184.24 g/mol. Its IUPAC name is naphthalene;prop-2-enal.
Molecular Properties
| Compound Name | naphthalene;prop-2-enal |
| PubChem CID | 174260828 |
| Molecular Formula | C13H12O |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | naphthalene;prop-2-enal |
| SMILES | C=CC=O.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.C3H4O/c1-2-6-10-8-4-3-7-9(10)5-1;1-2-3-4/h1-8H;2-3H,1H2 |
| InChIKey | MFZHDIYAGYHXFS-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze naphthalene;prop-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalene;prop-2-enal?
The IUPAC name of naphthalene;prop-2-enal (CID 174260828) is naphthalene;prop-2-enal.
What is the SMILES notation for naphthalene;prop-2-enal?
The canonical SMILES for naphthalene;prop-2-enal is C=CC=O.c1ccc2ccccc2c1.
What is the InChIKey of naphthalene;prop-2-enal?
The InChIKey is MFZHDIYAGYHXFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.C3H4O/c1-2-6-10-8-4-3-7-9(10)5-1;1-2-3-4/h1-8H;2-3H,1H2.
What are the key properties of naphthalene;prop-2-enal?
naphthalene;prop-2-enal has a molecular weight of 184.24 g/mol, XLogP of 3.21, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalene;prop-2-enal is sourced from PubChem (CID 174260828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).