About formyl formate;naphthalene;hydrobromide
formyl formate;naphthalene;hydrobromide (PubChem CID 174587967) has the molecular formula C12H11BrO3
and a molecular weight of 283.12 g/mol. Its IUPAC name is formyl formate;naphthalene;hydrobromide.
Molecular Properties
| Compound Name | formyl formate;naphthalene;hydrobromide |
| PubChem CID | 174587967 |
| Molecular Formula | C12H11BrO3 |
| Molecular Weight | 283.12 g/mol |
| Exact Mass | 281.99 |
| IUPAC Name | formyl formate;naphthalene;hydrobromide |
| SMILES | Br.O=COC=O.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.C2H2O3.BrH/c1-2-6-10-8-4-3-7-9(10)5-1;3-1-5-2-4;/h1-8H;1-2H;1H |
| InChIKey | MRYIKHUWYFUHJC-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.12 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze formyl formate;naphthalene;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formyl formate;naphthalene;hydrobromide?
The IUPAC name of formyl formate;naphthalene;hydrobromide (CID 174587967) is formyl formate;naphthalene;hydrobromide.
What is the SMILES notation for formyl formate;naphthalene;hydrobromide?
The canonical SMILES for formyl formate;naphthalene;hydrobromide is Br.O=COC=O.c1ccc2ccccc2c1.
What is the InChIKey of formyl formate;naphthalene;hydrobromide?
The InChIKey is MRYIKHUWYFUHJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.C2H2O3.BrH/c1-2-6-10-8-4-3-7-9(10)5-1;3-1-5-2-4;/h1-8H;1-2H;1H.
What are the key properties of formyl formate;naphthalene;hydrobromide?
formyl formate;naphthalene;hydrobromide has a molecular weight of 283.12 g/mol, XLogP of 2.73, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for formyl formate;naphthalene;hydrobromide is sourced from PubChem (CID 174587967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).