C10H8N2O3 — CID 155633061
[2-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl] formate (PubChem CID 155633061) has the molecular formula C10H8N2O3 and a molecular weight of 204.19 g/mol. Its IUPAC name is [2-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl] formate.
| Compound Name | [2-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl] formate |
|---|---|
| PubChem CID | 155633061 |
| Molecular Formula | C10H8N2O3 |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | [2-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl] formate |
| SMILES | Cc1noc(-c2ccccc2OC=O)n1 |
| InChI | InChI=1S/C10H8N2O3/c1-7-11-10(15-12-7)8-4-2-3-5-9(8)14-6-13/h2-6H,1H3 |
| InChIKey | WWCYCHADROVABA-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|