About 2-fluoro-6-(3-methyl-1,2,4-oxadiazol-5-yl)phenol
2-fluoro-6-(3-methyl-1,2,4-oxadiazol-5-yl)phenol (PubChem CID 136898430) has the molecular formula C9H7FN2O2
and a molecular weight of 194.17 g/mol. Its IUPAC name is 2-fluoro-6-(3-methyl-1,2,4-oxadiazol-5-yl)phenol.
Molecular Properties
| Compound Name | 2-fluoro-6-(3-methyl-1,2,4-oxadiazol-5-yl)phenol |
| PubChem CID | 136898430 |
| Molecular Formula | C9H7FN2O2 |
| Molecular Weight | 194.17 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | 2-fluoro-6-(3-methyl-1,2,4-oxadiazol-5-yl)phenol |
| SMILES | Cc1noc(-c2cccc(F)c2O)n1 |
| InChI | InChI=1S/C9H7FN2O2/c1-5-11-9(14-12-5)6-3-2-4-7(10)8(6)13/h2-4,13H,1H3 |
| InChIKey | IHTOPBGIEVNYSL-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.17 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-fluoro-6-(3-methyl-1,2,4-oxadiazol-5-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-6-(3-methyl-1,2,4-oxadiazol-5-yl)phenol?
The IUPAC name of 2-fluoro-6-(3-methyl-1,2,4-oxadiazol-5-yl)phenol (CID 136898430) is 2-fluoro-6-(3-methyl-1,2,4-oxadiazol-5-yl)phenol.
What is the SMILES notation for 2-fluoro-6-(3-methyl-1,2,4-oxadiazol-5-yl)phenol?
The canonical SMILES for 2-fluoro-6-(3-methyl-1,2,4-oxadiazol-5-yl)phenol is Cc1noc(-c2cccc(F)c2O)n1.
What is the InChIKey of 2-fluoro-6-(3-methyl-1,2,4-oxadiazol-5-yl)phenol?
The InChIKey is IHTOPBGIEVNYSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7FN2O2/c1-5-11-9(14-12-5)6-3-2-4-7(10)8(6)13/h2-4,13H,1H3.
What are the key properties of 2-fluoro-6-(3-methyl-1,2,4-oxadiazol-5-yl)phenol?
2-fluoro-6-(3-methyl-1,2,4-oxadiazol-5-yl)phenol has a molecular weight of 194.17 g/mol, XLogP of 1.89, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-6-(3-methyl-1,2,4-oxadiazol-5-yl)phenol is sourced from PubChem (CID 136898430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).