C9H8N2O3 — CID 136813400
2-(3-methyl-1,2,4-oxadiazol-5-yl)benzene-1,3-diol (PubChem CID 136813400) has the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. Its IUPAC name is 2-(3-methyl-1,2,4-oxadiazol-5-yl)benzene-1,3-diol.
| Compound Name | 2-(3-methyl-1,2,4-oxadiazol-5-yl)benzene-1,3-diol |
|---|---|
| PubChem CID | 136813400 |
| Molecular Formula | C9H8N2O3 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 2-(3-methyl-1,2,4-oxadiazol-5-yl)benzene-1,3-diol |
| SMILES | Cc1noc(-c2c(O)cccc2O)n1 |
| InChI | InChI=1S/C9H8N2O3/c1-5-10-9(14-11-5)8-6(12)3-2-4-7(8)13/h2-4,12-13H,1H3 |
| InChIKey | FBUDLMMVZSPHKC-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |