C16H14N2O3 — CID 136813443
2-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]benzene-1,3-diol (PubChem CID 136813443) has the molecular formula C16H14N2O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is 2-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]benzene-1,3-diol.
| Compound Name | 2-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]benzene-1,3-diol |
|---|---|
| PubChem CID | 136813443 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 2-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]benzene-1,3-diol |
| SMILES | Oc1cccc(O)c1-c1nc(CCc2ccccc2)no1 |
| InChI | InChI=1S/C16H14N2O3/c19-12-7-4-8-13(20)15(12)16-17-14(18-21-16)10-9-11-5-2-1-3-6-11/h1-8,19-20H,9-10H2 |
| InChIKey | QPVRJTKMYVMDIF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |