C15H14N4O3S — CID 99839607
4-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]pyridine-2-sulfonamide (PubChem CID 99839607) has the molecular formula C15H14N4O3S and a molecular weight of 330.37 g/mol. Its IUPAC name is 4-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]pyridine-2-sulfonamide.
| Compound Name | 4-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 99839607 |
| Molecular Formula | C15H14N4O3S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 4-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]pyridine-2-sulfonamide |
| SMILES | NS(=O)(=O)c1cc(-c2nc(CCc3ccccc3)no2)ccn1 |
| InChI | InChI=1S/C15H14N4O3S/c16-23(20,21)14-10-12(8-9-17-14)15-18-13(19-22-15)7-6-11-4-2-1-3-5-11/h1-5,8-10H,6-7H2,(H2,16,20,21) |
| InChIKey | ZHDPLBYVYXRRMY-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 111.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |