About 4-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]pyridine-2-sulfonamide
4-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]pyridine-2-sulfonamide (PubChem CID 99839607) has the molecular formula C15H14N4O3S
and a molecular weight of 330.37 g/mol. Its IUPAC name is 4-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]pyridine-2-sulfonamide.
Molecular Properties
| Compound Name | 4-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]pyridine-2-sulfonamide |
| PubChem CID | 99839607 |
| Molecular Formula | C15H14N4O3S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 4-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]pyridine-2-sulfonamide |
| SMILES | NS(=O)(=O)c1cc(-c2nc(CCc3ccccc3)no2)ccn1 |
| InChI | InChI=1S/C15H14N4O3S/c16-23(20,21)14-10-12(8-9-17-14)15-18-13(19-22-15)7-6-11-4-2-1-3-5-11/h1-5,8-10H,6-7H2,(H2,16,20,21) |
| InChIKey | ZHDPLBYVYXRRMY-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 111.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]pyridine-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]pyridine-2-sulfonamide?
The IUPAC name of 4-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]pyridine-2-sulfonamide (CID 99839607) is 4-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]pyridine-2-sulfonamide.
What is the SMILES notation for 4-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]pyridine-2-sulfonamide?
The canonical SMILES for 4-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]pyridine-2-sulfonamide is NS(=O)(=O)c1cc(-c2nc(CCc3ccccc3)no2)ccn1.
What is the InChIKey of 4-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]pyridine-2-sulfonamide?
The InChIKey is ZHDPLBYVYXRRMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N4O3S/c16-23(20,21)14-10-12(8-9-17-14)15-18-13(19-22-15)7-6-11-4-2-1-3-5-11/h1-5,8-10H,6-7H2,(H2,16,20,21).
What are the key properties of 4-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]pyridine-2-sulfonamide?
4-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]pyridine-2-sulfonamide has a molecular weight of 330.37 g/mol, XLogP of 1.56, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]pyridine-2-sulfonamide is sourced from PubChem (CID 99839607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).