C14H10FN3O2 — CID 136712713
2-amino-6-[3-(2-fluorophenyl)-1,2,4-oxadiazol-5-yl]phenol (PubChem CID 136712713) has the molecular formula C14H10FN3O2 and a molecular weight of 271.25 g/mol. Its IUPAC name is 2-amino-6-[3-(2-fluorophenyl)-1,2,4-oxadiazol-5-yl]phenol.
| Compound Name | 2-amino-6-[3-(2-fluorophenyl)-1,2,4-oxadiazol-5-yl]phenol |
|---|---|
| PubChem CID | 136712713 |
| Molecular Formula | C14H10FN3O2 |
| Molecular Weight | 271.25 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 2-amino-6-[3-(2-fluorophenyl)-1,2,4-oxadiazol-5-yl]phenol |
| SMILES | Nc1cccc(-c2nc(-c3ccccc3F)no2)c1O |
| InChI | InChI=1S/C14H10FN3O2/c15-10-6-2-1-4-8(10)13-17-14(20-18-13)9-5-3-7-11(16)12(9)19/h1-7,19H,16H2 |
| InChIKey | KZVCUZPZNJZHIW-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.25 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|