C14H10FN3O — CID 42281998
3-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]aniline (PubChem CID 42281998) has the molecular formula C14H10FN3O and a molecular weight of 255.25 g/mol. Its IUPAC name is 3-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]aniline.
| Compound Name | 3-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]aniline |
|---|---|
| PubChem CID | 42281998 |
| Molecular Formula | C14H10FN3O |
| Molecular Weight | 255.25 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 3-[5-(2-fluorophenyl)-1,2,4-oxadiazol-3-yl]aniline |
| SMILES | Nc1cccc(-c2noc(-c3ccccc3F)n2)c1 |
| InChI | InChI=1S/C14H10FN3O/c15-12-7-2-1-6-11(12)14-17-13(18-19-14)9-4-3-5-10(16)8-9/h1-8H,16H2 |
| InChIKey | RTNQIBXXYJIDEX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.25 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|