C14H8F3N3O — CID 79755139
3-[5-(2,3,4-trifluorophenyl)-1,2,4-oxadiazol-3-yl]aniline (PubChem CID 79755139) has the molecular formula C14H8F3N3O and a molecular weight of 291.23 g/mol. Its IUPAC name is 3-[5-(2,3,4-trifluorophenyl)-1,2,4-oxadiazol-3-yl]aniline.
| Compound Name | 3-[5-(2,3,4-trifluorophenyl)-1,2,4-oxadiazol-3-yl]aniline |
|---|---|
| PubChem CID | 79755139 |
| Molecular Formula | C14H8F3N3O |
| Molecular Weight | 291.23 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 3-[5-(2,3,4-trifluorophenyl)-1,2,4-oxadiazol-3-yl]aniline |
| SMILES | Nc1cccc(-c2noc(-c3ccc(F)c(F)c3F)n2)c1 |
| InChI | InChI=1S/C14H8F3N3O/c15-10-5-4-9(11(16)12(10)17)14-19-13(20-21-14)7-2-1-3-8(18)6-7/h1-6H,18H2 |
| InChIKey | WHBLQGVXOGPINU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.23 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|