C14H8ClFN2O2 — CID 80979825
3-[5-(3-chloro-2-fluorophenyl)-1,2,4-oxadiazol-3-yl]phenol (PubChem CID 80979825) has the molecular formula C14H8ClFN2O2 and a molecular weight of 290.68 g/mol. Its IUPAC name is 3-[5-(3-chloro-2-fluorophenyl)-1,2,4-oxadiazol-3-yl]phenol.
| Compound Name | 3-[5-(3-chloro-2-fluorophenyl)-1,2,4-oxadiazol-3-yl]phenol |
|---|---|
| PubChem CID | 80979825 |
| Molecular Formula | C14H8ClFN2O2 |
| Molecular Weight | 290.68 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | 3-[5-(3-chloro-2-fluorophenyl)-1,2,4-oxadiazol-3-yl]phenol |
| SMILES | Oc1cccc(-c2noc(-c3cccc(Cl)c3F)n2)c1 |
| InChI | InChI=1S/C14H8ClFN2O2/c15-11-6-2-5-10(12(11)16)14-17-13(18-20-14)8-3-1-4-9(19)7-8/h1-7,19H |
| InChIKey | ZIGAXRZLRDOCMT-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.68 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |