C14H10N2O3 — CID 136809760
2-[3-(3-hydroxyphenyl)-1,2,4-oxadiazol-5-yl]phenol (PubChem CID 136809760) has the molecular formula C14H10N2O3 and a molecular weight of 254.25 g/mol. Its IUPAC name is 2-[3-(3-hydroxyphenyl)-1,2,4-oxadiazol-5-yl]phenol.
| Compound Name | 2-[3-(3-hydroxyphenyl)-1,2,4-oxadiazol-5-yl]phenol |
|---|---|
| PubChem CID | 136809760 |
| Molecular Formula | C14H10N2O3 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 2-[3-(3-hydroxyphenyl)-1,2,4-oxadiazol-5-yl]phenol |
| SMILES | Oc1cccc(-c2noc(-c3ccccc3O)n2)c1 |
| InChI | InChI=1S/C14H10N2O3/c17-10-5-3-4-9(8-10)13-15-14(19-16-13)11-6-1-2-7-12(11)18/h1-8,17-18H |
| InChIKey | WVTNFKBINARCBL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |