C15H12N2O3 — CID 107922223
2-[[3-(3-hydroxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]phenol (PubChem CID 107922223) has the molecular formula C15H12N2O3 and a molecular weight of 268.27 g/mol. Its IUPAC name is 2-[[3-(3-hydroxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]phenol.
| Compound Name | 2-[[3-(3-hydroxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]phenol |
|---|---|
| PubChem CID | 107922223 |
| Molecular Formula | C15H12N2O3 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 2-[[3-(3-hydroxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]phenol |
| SMILES | Oc1cccc(-c2noc(Cc3ccccc3O)n2)c1 |
| InChI | InChI=1S/C15H12N2O3/c18-12-6-3-5-11(8-12)15-16-14(20-17-15)9-10-4-1-2-7-13(10)19/h1-8,18-19H,9H2 |
| InChIKey | IXPWVHMIYNNGCP-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |