C11H13N3O3 — CID 103822428
3-[5-(2-aminoethoxymethyl)-1,2,4-oxadiazol-3-yl]phenol (PubChem CID 103822428) has the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. Its IUPAC name is 3-[5-(2-aminoethoxymethyl)-1,2,4-oxadiazol-3-yl]phenol.
| Compound Name | 3-[5-(2-aminoethoxymethyl)-1,2,4-oxadiazol-3-yl]phenol |
|---|---|
| PubChem CID | 103822428 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 3-[5-(2-aminoethoxymethyl)-1,2,4-oxadiazol-3-yl]phenol |
| SMILES | NCCOCc1nc(-c2cccc(O)c2)no1 |
| InChI | InChI=1S/C11H13N3O3/c12-4-5-16-7-10-13-11(14-17-10)8-2-1-3-9(15)6-8/h1-3,6,15H,4-5,7,12H2 |
| InChIKey | BICVEWRJZGYWDW-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|