C11H10F3N3O2 — CID 79463409
2-[[3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazol-5-yl]methoxy]ethanamine (PubChem CID 79463409) has the molecular formula C11H10F3N3O2 and a molecular weight of 273.21 g/mol. Its IUPAC name is 2-[[3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazol-5-yl]methoxy]ethanamine.
| Compound Name | 2-[[3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazol-5-yl]methoxy]ethanamine |
|---|---|
| PubChem CID | 79463409 |
| Molecular Formula | C11H10F3N3O2 |
| Molecular Weight | 273.21 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 2-[[3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazol-5-yl]methoxy]ethanamine |
| SMILES | NCCOCc1nc(-c2cc(F)c(F)c(F)c2)no1 |
| InChI | InChI=1S/C11H10F3N3O2/c12-7-3-6(4-8(13)10(7)14)11-16-9(19-17-11)5-18-2-1-15/h3-4H,1-2,5,15H2 |
| InChIKey | IOZAZBHAJQDUHC-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.21 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|