C11H6F3N3OS — CID 103792256
2-[[3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]acetonitrile (PubChem CID 103792256) has the molecular formula C11H6F3N3OS and a molecular weight of 285.25 g/mol. Its IUPAC name is 2-[[3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]acetonitrile.
| Compound Name | 2-[[3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]acetonitrile |
|---|---|
| PubChem CID | 103792256 |
| Molecular Formula | C11H6F3N3OS |
| Molecular Weight | 285.25 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | 2-[[3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]acetonitrile |
| SMILES | N#CCSCc1nc(-c2cc(F)c(F)c(F)c2)no1 |
| InChI | InChI=1S/C11H6F3N3OS/c12-7-3-6(4-8(13)10(7)14)11-16-9(18-17-11)5-19-2-1-15/h3-4H,2,5H2 |
| InChIKey | QDLYRGRSDORMAT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 62.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.25 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|