C13H9F3N2O2 — CID 63344981
1-cyclopropyl-2-[3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazol-5-yl]ethanone (PubChem CID 63344981) has the molecular formula C13H9F3N2O2 and a molecular weight of 282.22 g/mol. Its IUPAC name is 1-cyclopropyl-2-[3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazol-5-yl]ethanone.
| Compound Name | 1-cyclopropyl-2-[3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazol-5-yl]ethanone |
|---|---|
| PubChem CID | 63344981 |
| Molecular Formula | C13H9F3N2O2 |
| Molecular Weight | 282.22 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 1-cyclopropyl-2-[3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazol-5-yl]ethanone |
| SMILES | O=C(Cc1nc(-c2cc(F)c(F)c(F)c2)no1)C1CC1 |
| InChI | InChI=1S/C13H9F3N2O2/c14-8-3-7(4-9(15)12(8)16)13-17-11(20-18-13)5-10(19)6-1-2-6/h3-4,6H,1-2,5H2 |
| InChIKey | REIJRTXPPYPUOQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.22 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|