C13H14F3N3O — CID 82688095
2-methyl-4-[3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazol-5-yl]butan-1-amine (PubChem CID 82688095) has the molecular formula C13H14F3N3O and a molecular weight of 285.27 g/mol. Its IUPAC name is 2-methyl-4-[3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazol-5-yl]butan-1-amine.
| Compound Name | 2-methyl-4-[3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazol-5-yl]butan-1-amine |
|---|---|
| PubChem CID | 82688095 |
| Molecular Formula | C13H14F3N3O |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 2-methyl-4-[3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazol-5-yl]butan-1-amine |
| SMILES | CC(CN)CCc1nc(-c2cc(F)c(F)c(F)c2)no1 |
| InChI | InChI=1S/C13H14F3N3O/c1-7(6-17)2-3-11-18-13(19-20-11)8-4-9(14)12(16)10(15)5-8/h4-5,7H,2-3,6,17H2,1H3 |
| InChIKey | QOMDAWOGJQTXAY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|