C12H10FN3O2S — CID 104676934
2-[[3-(4-fluoro-3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]acetonitrile (PubChem CID 104676934) has the molecular formula C12H10FN3O2S and a molecular weight of 279.30 g/mol. Its IUPAC name is 2-[[3-(4-fluoro-3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]acetonitrile.
| Compound Name | 2-[[3-(4-fluoro-3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]acetonitrile |
|---|---|
| PubChem CID | 104676934 |
| Molecular Formula | C12H10FN3O2S |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 2-[[3-(4-fluoro-3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]acetonitrile |
| SMILES | COc1cc(-c2noc(CSCC#N)n2)ccc1F |
| InChI | InChI=1S/C12H10FN3O2S/c1-17-10-6-8(2-3-9(10)13)12-15-11(18-16-12)7-19-5-4-14/h2-3,6H,5,7H2,1H3 |
| InChIKey | ZCXJJANGISSEDT-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 71.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|