C14H14FN3OS — CID 106525403
2-[[3-[2-(4-fluorophenyl)propan-2-yl]-1,2,4-oxadiazol-5-yl]methylsulfanyl]acetonitrile (PubChem CID 106525403) has the molecular formula C14H14FN3OS and a molecular weight of 291.35 g/mol. Its IUPAC name is 2-[[3-[2-(4-fluorophenyl)propan-2-yl]-1,2,4-oxadiazol-5-yl]methylsulfanyl]acetonitrile.
| Compound Name | 2-[[3-[2-(4-fluorophenyl)propan-2-yl]-1,2,4-oxadiazol-5-yl]methylsulfanyl]acetonitrile |
|---|---|
| PubChem CID | 106525403 |
| Molecular Formula | C14H14FN3OS |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 2-[[3-[2-(4-fluorophenyl)propan-2-yl]-1,2,4-oxadiazol-5-yl]methylsulfanyl]acetonitrile |
| SMILES | CC(C)(c1ccc(F)cc1)c1noc(CSCC#N)n1 |
| InChI | InChI=1S/C14H14FN3OS/c1-14(2,10-3-5-11(15)6-4-10)13-17-12(19-18-13)9-20-8-7-16/h3-6H,8-9H2,1-2H3 |
| InChIKey | FNECIXDCDYXUTL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 62.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|