C12H19N3O2S — CID 106526891
2-[[3-(3-ethoxypentan-3-yl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]acetonitrile (PubChem CID 106526891) has the molecular formula C12H19N3O2S and a molecular weight of 269.37 g/mol. Its IUPAC name is 2-[[3-(3-ethoxypentan-3-yl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]acetonitrile.
| Compound Name | 2-[[3-(3-ethoxypentan-3-yl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]acetonitrile |
|---|---|
| PubChem CID | 106526891 |
| Molecular Formula | C12H19N3O2S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 2-[[3-(3-ethoxypentan-3-yl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]acetonitrile |
| SMILES | CCOC(CC)(CC)c1noc(CSCC#N)n1 |
| InChI | InChI=1S/C12H19N3O2S/c1-4-12(5-2,16-6-3)11-14-10(17-15-11)9-18-8-7-13/h4-6,8-9H2,1-3H3 |
| InChIKey | XWZGPLKYZIWGIO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 71.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|