C12H14N2O3 — CID 91572495
5-(2-methoxyethoxymethyl)-3-phenyl-1,2,4-oxadiazole (PubChem CID 91572495) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is 5-(2-methoxyethoxymethyl)-3-phenyl-1,2,4-oxadiazole.
| Compound Name | 5-(2-methoxyethoxymethyl)-3-phenyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 91572495 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 5-(2-methoxyethoxymethyl)-3-phenyl-1,2,4-oxadiazole |
| SMILES | COCCOCc1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C12H14N2O3/c1-15-7-8-16-9-11-13-12(14-17-11)10-5-3-2-4-6-10/h2-6H,7-9H2,1H3 |
| InChIKey | PEKCIAWWKYCROZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|