C13H16N2O3 — CID 78953778
3-[5-(3-ethoxypropyl)-1,2,4-oxadiazol-3-yl]phenol (PubChem CID 78953778) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 3-[5-(3-ethoxypropyl)-1,2,4-oxadiazol-3-yl]phenol.
| Compound Name | 3-[5-(3-ethoxypropyl)-1,2,4-oxadiazol-3-yl]phenol |
|---|---|
| PubChem CID | 78953778 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 3-[5-(3-ethoxypropyl)-1,2,4-oxadiazol-3-yl]phenol |
| SMILES | CCOCCCc1nc(-c2cccc(O)c2)no1 |
| InChI | InChI=1S/C13H16N2O3/c1-2-17-8-4-7-12-14-13(15-18-12)10-5-3-6-11(16)9-10/h3,5-6,9,16H,2,4,7-8H2,1H3 |
| InChIKey | FXGYMOXQISLVEG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|