C15H19N3O2 — CID 107921225
3-[5-(2-piperidin-4-ylethyl)-1,2,4-oxadiazol-3-yl]phenol (PubChem CID 107921225) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 3-[5-(2-piperidin-4-ylethyl)-1,2,4-oxadiazol-3-yl]phenol.
| Compound Name | 3-[5-(2-piperidin-4-ylethyl)-1,2,4-oxadiazol-3-yl]phenol |
|---|---|
| PubChem CID | 107921225 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 3-[5-(2-piperidin-4-ylethyl)-1,2,4-oxadiazol-3-yl]phenol |
| SMILES | Oc1cccc(-c2noc(CCC3CCNCC3)n2)c1 |
| InChI | InChI=1S/C15H19N3O2/c19-13-3-1-2-12(10-13)15-17-14(20-18-15)5-4-11-6-8-16-9-7-11/h1-3,10-11,16,19H,4-9H2 |
| InChIKey | NRPUNCQQTXUBIX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |