C14H17N3O2 — CID 107921243
3-[5-(piperidin-3-ylmethyl)-1,2,4-oxadiazol-3-yl]phenol (PubChem CID 107921243) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is 3-[5-(piperidin-3-ylmethyl)-1,2,4-oxadiazol-3-yl]phenol.
| Compound Name | 3-[5-(piperidin-3-ylmethyl)-1,2,4-oxadiazol-3-yl]phenol |
|---|---|
| PubChem CID | 107921243 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 3-[5-(piperidin-3-ylmethyl)-1,2,4-oxadiazol-3-yl]phenol |
| SMILES | Oc1cccc(-c2noc(CC3CCCNC3)n2)c1 |
| InChI | InChI=1S/C14H17N3O2/c18-12-5-1-4-11(8-12)14-16-13(19-17-14)7-10-3-2-6-15-9-10/h1,4-5,8,10,15,18H,2-3,6-7,9H2 |
| InChIKey | QGHZARJFXHYNQX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |