C12H12ClN3O — CID 64612280
5-(azetidin-3-ylmethyl)-3-(3-chlorophenyl)-1,2,4-oxadiazole (PubChem CID 64612280) has the molecular formula C12H12ClN3O and a molecular weight of 249.70 g/mol. Its IUPAC name is 5-(azetidin-3-ylmethyl)-3-(3-chlorophenyl)-1,2,4-oxadiazole.
| Compound Name | 5-(azetidin-3-ylmethyl)-3-(3-chlorophenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 64612280 |
| Molecular Formula | C12H12ClN3O |
| Molecular Weight | 249.70 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 5-(azetidin-3-ylmethyl)-3-(3-chlorophenyl)-1,2,4-oxadiazole |
| SMILES | Clc1cccc(-c2noc(CC3CNC3)n2)c1 |
| InChI | InChI=1S/C12H12ClN3O/c13-10-3-1-2-9(5-10)12-15-11(17-16-12)4-8-6-14-7-8/h1-3,5,8,14H,4,6-7H2 |
| InChIKey | BOSWHSZVVOEDCJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.70 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |