C17H20F3N3O3 — CID 100756276
N-(3-ethoxypropyl)-3-[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]propanamide (PubChem CID 100756276) has the molecular formula C17H20F3N3O3 and a molecular weight of 371.36 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-3-[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]propanamide.
| Compound Name | N-(3-ethoxypropyl)-3-[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]propanamide |
|---|---|
| PubChem CID | 100756276 |
| Molecular Formula | C17H20F3N3O3 |
| Molecular Weight | 371.36 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | N-(3-ethoxypropyl)-3-[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]propanamide |
| SMILES | CCOCCCNC(=O)CCc1nc(-c2cccc(C(F)(F)F)c2)no1 |
| InChI | InChI=1S/C17H20F3N3O3/c1-2-25-10-4-9-21-14(24)7-8-15-22-16(23-26-15)12-5-3-6-13(11-12)17(18,19)20/h3,5-6,11H,2,4,7-10H2,1H3,(H,21,24) |
| InChIKey | WDUDNBAWUCYGKO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|