C18H22F3N3O3 — CID 100756287
N-(3-propan-2-yloxypropyl)-3-[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]propanamide (PubChem CID 100756287) has the molecular formula C18H22F3N3O3 and a molecular weight of 385.39 g/mol. Its IUPAC name is N-(3-propan-2-yloxypropyl)-3-[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]propanamide.
| Compound Name | N-(3-propan-2-yloxypropyl)-3-[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]propanamide |
|---|---|
| PubChem CID | 100756287 |
| Molecular Formula | C18H22F3N3O3 |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | N-(3-propan-2-yloxypropyl)-3-[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]propanamide |
| SMILES | CC(C)OCCCNC(=O)CCc1nc(-c2cccc(C(F)(F)F)c2)no1 |
| InChI | InChI=1S/C18H22F3N3O3/c1-12(2)26-10-4-9-22-15(25)7-8-16-23-17(24-27-16)13-5-3-6-14(11-13)18(19,20)21/h3,5-6,11-12H,4,7-10H2,1-2H3,(H,22,25) |
| InChIKey | WYBXZEFKNDPYRI-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|