C12H13N3O2 — CID 114016052
3-[5-[(prop-2-enylamino)methyl]-1,2,4-oxadiazol-3-yl]phenol (PubChem CID 114016052) has the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. Its IUPAC name is 3-[5-[(prop-2-enylamino)methyl]-1,2,4-oxadiazol-3-yl]phenol.
| Compound Name | 3-[5-[(prop-2-enylamino)methyl]-1,2,4-oxadiazol-3-yl]phenol |
|---|---|
| PubChem CID | 114016052 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 3-[5-[(prop-2-enylamino)methyl]-1,2,4-oxadiazol-3-yl]phenol |
| SMILES | C=CCNCc1nc(-c2cccc(O)c2)no1 |
| InChI | InChI=1S/C12H13N3O2/c1-2-6-13-8-11-14-12(15-17-11)9-4-3-5-10(16)7-9/h2-5,7,13,16H,1,6,8H2 |
| InChIKey | OXIDDVJNWYYILW-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|